C24H28FN5O3 — CID 71572913
6-[3-(3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl)propoxy]-N-(4-fluorophenyl)-7-methoxyquinazolin-4-amine (PubChem CID 71572913) has the molecular formula C24H28FN5O3 and a molecular weight of 453.52 g/mol. Its IUPAC name is 6-[3-(3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl)propoxy]-N-(4-fluorophenyl)-7-methoxyquinazolin-4-amine.
| Compound Name | 6-[3-(3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl)propoxy]-N-(4-fluorophenyl)-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 71572913 |
| Molecular Formula | C24H28FN5O3 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 6-[3-(3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl)propoxy]-N-(4-fluorophenyl)-7-methoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(F)cc3)c2cc1OCCCN1CC2NCCOC2C1 |
| InChI | InChI=1S/C24H28FN5O3/c1-31-21-12-19-18(24(28-15-27-19)29-17-5-3-16(25)4-6-17)11-22(21)32-9-2-8-30-13-20-23(14-30)33-10-7-26-20/h3-6,11-12,15,20,23,26H,2,7-10,13-14H2,1H3,(H,27,28,29) |
| InChIKey | NGFSNRMIALLQSM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 80.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|