C27H26NO5+ — CID 71572997
4,4-dimethyl-2-(24-methyl-5,7,17,19-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-1(13),2,4(8),9,14,16(20),21,23-octaen-14-yl)pent-1-en-3-one (PubChem CID 71572997) has the molecular formula C27H26NO5+ and a molecular weight of 444.51 g/mol. Its IUPAC name is 4,4-dimethyl-2-(24-methyl-5,7,17,19-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-1(13),2,4(8),9,14,16(20),21,23-octaen-14-yl)pent-1-en-3-one.
| Compound Name | 4,4-dimethyl-2-(24-methyl-5,7,17,19-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-1(13),2,4(8),9,14,16(20),21,23-octaen-14-yl)pent-1-en-3-one |
|---|---|
| PubChem CID | 71572997 |
| Molecular Formula | C27H26NO5+ |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 4,4-dimethyl-2-(24-methyl-5,7,17,19-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-1(13),2,4(8),9,14,16(20),21,23-octaen-14-yl)pent-1-en-3-one |
| SMILES | C=C(C(=O)C(C)(C)C)c1c2c3c(ccc2c(C)c2[n+]1CCc1cc4c(cc1-2)OCO4)OCO3 |
| InChI | InChI=1S/C27H26NO5/c1-14-17-6-7-19-25(33-13-30-19)22(17)24(15(2)26(29)27(3,4)5)28-9-8-16-10-20-21(32-12-31-20)11-18(16)23(14)28/h6-7,10-11H,2,8-9,12-13H2,1,3-5H3/q+1 |
| InChIKey | KYMHOXARGCLFPK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|