C10H16O3 — CID 71573570
(4R,6R)-2,2,4-trimethyl-6-prop-2-enyl-1,3-dioxan-5-one (PubChem CID 71573570) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (4R,6R)-2,2,4-trimethyl-6-prop-2-enyl-1,3-dioxan-5-one.
| Compound Name | (4R,6R)-2,2,4-trimethyl-6-prop-2-enyl-1,3-dioxan-5-one |
|---|---|
| PubChem CID | 71573570 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (4R,6R)-2,2,4-trimethyl-6-prop-2-enyl-1,3-dioxan-5-one |
| SMILES | C=CC[C@H]1OC(C)(C)O[C@H](C)C1=O |
| InChI | InChI=1S/C10H16O3/c1-5-6-8-9(11)7(2)12-10(3,4)13-8/h5,7-8H,1,6H2,2-4H3/t7-,8-/m1/s1 |
| InChIKey | YIYUUFGAWCZNGG-HTQZYQBOSA-N |
| XLogP | 1.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|