C15H29NO3 — CID 71573725
(1S,2S,3S,6R)-4-methyl-6-(octylamino)cyclohex-4-ene-1,2,3-triol (PubChem CID 71573725) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is (1S,2S,3S,6R)-4-methyl-6-(octylamino)cyclohex-4-ene-1,2,3-triol.
| Compound Name | (1S,2S,3S,6R)-4-methyl-6-(octylamino)cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 71573725 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | (1S,2S,3S,6R)-4-methyl-6-(octylamino)cyclohex-4-ene-1,2,3-triol |
| SMILES | CCCCCCCCN[C@@H]1C=C(C)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H29NO3/c1-3-4-5-6-7-8-9-16-12-10-11(2)13(17)15(19)14(12)18/h10,12-19H,3-9H2,1-2H3/t12-,13+,14+,15+/m1/s1 |
| InChIKey | BMEFRIKNKKWYQM-QPSCCSFWSA-N |
| XLogP | 1.35 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|