C16H11N3O6 — CID 71573943
3-[(3,5-dinitroanilino)methyl]chromen-2-one (PubChem CID 71573943) has the molecular formula C16H11N3O6 and a molecular weight of 341.28 g/mol. Its IUPAC name is 3-[(3,5-dinitroanilino)methyl]chromen-2-one.
| Compound Name | 3-[(3,5-dinitroanilino)methyl]chromen-2-one |
|---|---|
| PubChem CID | 71573943 |
| Molecular Formula | C16H11N3O6 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 3-[(3,5-dinitroanilino)methyl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1CNc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H11N3O6/c20-16-11(5-10-3-1-2-4-15(10)25-16)9-17-12-6-13(18(21)22)8-14(7-12)19(23)24/h1-8,17H,9H2 |
| InChIKey | QQXMXCGQGVYDSP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|