C26H29N3O5 — CID 71574426
(3S,3aS,9bR)-8-[[3-(3,4-dimethoxyphenyl)triazol-4-yl]methoxy]-3,6,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one (PubChem CID 71574426) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is (3S,3aS,9bR)-8-[[3-(3,4-dimethoxyphenyl)triazol-4-yl]methoxy]-3,6,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one.
| Compound Name | (3S,3aS,9bR)-8-[[3-(3,4-dimethoxyphenyl)triazol-4-yl]methoxy]-3,6,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 71574426 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | (3S,3aS,9bR)-8-[[3-(3,4-dimethoxyphenyl)triazol-4-yl]methoxy]-3,6,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one |
| SMILES | COc1ccc(-n2nncc2COc2cc(C)c3c(c2C)[C@@H]2OC(=O)[C@@H](C)[C@@H]2CC3)cc1OC |
| InChI | InChI=1S/C26H29N3O5/c1-14-10-22(16(3)24-19(14)7-8-20-15(2)26(30)34-25(20)24)33-13-18-12-27-28-29(18)17-6-9-21(31-4)23(11-17)32-5/h6,9-12,15,20,25H,7-8,13H2,1-5H3/t15-,20-,25+/m0/s1 |
| InChIKey | ULJKZBMEQWSVGB-PCKXHRCSSA-N |
| XLogP | 4.28 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |