C25H25N3O5 — CID 71574427
(3S,3aS,9bR)-8-[[3-(1,3-benzodioxol-5-yl)triazol-4-yl]methoxy]-3,6,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one (PubChem CID 71574427) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is (3S,3aS,9bR)-8-[[3-(1,3-benzodioxol-5-yl)triazol-4-yl]methoxy]-3,6,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one.
| Compound Name | (3S,3aS,9bR)-8-[[3-(1,3-benzodioxol-5-yl)triazol-4-yl]methoxy]-3,6,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 71574427 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (3S,3aS,9bR)-8-[[3-(1,3-benzodioxol-5-yl)triazol-4-yl]methoxy]-3,6,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one |
| SMILES | Cc1cc(OCc2cnnn2-c2ccc3c(c2)OCO3)c(C)c2c1CC[C@H]1[C@H](C)C(=O)O[C@@H]21 |
| InChI | InChI=1S/C25H25N3O5/c1-13-8-21(15(3)23-18(13)5-6-19-14(2)25(29)33-24(19)23)30-11-17-10-26-27-28(17)16-4-7-20-22(9-16)32-12-31-20/h4,7-10,14,19,24H,5-6,11-12H2,1-3H3/t14-,19-,24+/m0/s1 |
| InChIKey | KZGVJQZSNHTVSG-BSTGMLCMSA-N |
| XLogP | 3.99 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |