About 2-(3,3-dimethoxypropylimino)naphthalene-1,4-dione
2-(3,3-dimethoxypropylimino)naphthalene-1,4-dione (PubChem CID 7157446) has the molecular formula C15H17NO4
and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-(3,3-dimethoxypropylimino)naphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2-(3,3-dimethoxypropylimino)naphthalene-1,4-dione |
| PubChem CID | 7157446 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-(3,3-dimethoxypropylimino)naphthalene-1,4-dione |
| SMILES | COC(CC/N=C1\CC(=O)c2ccccc2C1=O)OC |
| InChI | InChI=1S/C15H17NO4/c1-19-14(20-2)7-8-16-12-9-13(17)10-5-3-4-6-11(10)15(12)18/h3-6,14H,7-9H2,1-2H3/b16-12+ |
| InChIKey | FHPSXXZZPGDYIQ-FOWTUZBSSA-N |
| XLogP | 1.91 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3-dimethoxypropylimino)naphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethoxypropylimino)naphthalene-1,4-dione?
The IUPAC name of 2-(3,3-dimethoxypropylimino)naphthalene-1,4-dione (CID 7157446) is 2-(3,3-dimethoxypropylimino)naphthalene-1,4-dione.
What is the SMILES notation for 2-(3,3-dimethoxypropylimino)naphthalene-1,4-dione?
The canonical SMILES for 2-(3,3-dimethoxypropylimino)naphthalene-1,4-dione is COC(CC/N=C1\CC(=O)c2ccccc2C1=O)OC.
What is the InChIKey of 2-(3,3-dimethoxypropylimino)naphthalene-1,4-dione?
The InChIKey is FHPSXXZZPGDYIQ-FOWTUZBSSA-N. The full InChI is InChI=1S/C15H17NO4/c1-19-14(20-2)7-8-16-12-9-13(17)10-5-3-4-6-11(10)15(12)18/h3-6,14H,7-9H2,1-2H3/b16-12+.
What are the key properties of 2-(3,3-dimethoxypropylimino)naphthalene-1,4-dione?
2-(3,3-dimethoxypropylimino)naphthalene-1,4-dione has a molecular weight of 275.30 g/mol, XLogP of 1.91, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethoxypropylimino)naphthalene-1,4-dione is sourced from PubChem (CID 7157446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).