C18H14N4O3S — CID 71574497
5,5-diphenyl-3-[(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)methyl]imidazolidine-2,4-dione (PubChem CID 71574497) has the molecular formula C18H14N4O3S and a molecular weight of 366.40 g/mol. Its IUPAC name is 5,5-diphenyl-3-[(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-diphenyl-3-[(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71574497 |
| Molecular Formula | C18H14N4O3S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 5,5-diphenyl-3-[(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1Cc1n[nH]c(=S)o1 |
| InChI | InChI=1S/C18H14N4O3S/c23-15-18(12-7-3-1-4-8-12,13-9-5-2-6-10-13)19-16(24)22(15)11-14-20-21-17(26)25-14/h1-10H,11H2,(H,19,24)(H,21,26) |
| InChIKey | UNEOPHOCJOVLGI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|