C27H31N3O6 — CID 71574526
(3S,3aS,9bR)-3,6,9-trimethyl-8-[[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]methoxy]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one (PubChem CID 71574526) has the molecular formula C27H31N3O6 and a molecular weight of 493.56 g/mol. Its IUPAC name is (3S,3aS,9bR)-3,6,9-trimethyl-8-[[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]methoxy]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one.
| Compound Name | (3S,3aS,9bR)-3,6,9-trimethyl-8-[[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]methoxy]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 71574526 |
| Molecular Formula | C27H31N3O6 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | (3S,3aS,9bR)-3,6,9-trimethyl-8-[[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]methoxy]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one |
| SMILES | COc1cc(-n2nncc2COc2cc(C)c3c(c2C)[C@@H]2OC(=O)[C@@H](C)[C@@H]2CC3)cc(OC)c1OC |
| InChI | InChI=1S/C27H31N3O6/c1-14-9-21(16(3)24-19(14)7-8-20-15(2)27(31)36-25(20)24)35-13-18-12-28-29-30(18)17-10-22(32-4)26(34-6)23(11-17)33-5/h9-12,15,20,25H,7-8,13H2,1-6H3/t15-,20-,25+/m0/s1 |
| InChIKey | KNFVLVKRWRQYMN-PCKXHRCSSA-N |
| XLogP | 4.29 |
| TPSA | 93.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |