C30H29N3O3 — CID 71574527
(3S,3aS,9bR)-3,6,9-trimethyl-8-[[3-(4-phenylphenyl)triazol-4-yl]methoxy]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one (PubChem CID 71574527) has the molecular formula C30H29N3O3 and a molecular weight of 479.58 g/mol. Its IUPAC name is (3S,3aS,9bR)-3,6,9-trimethyl-8-[[3-(4-phenylphenyl)triazol-4-yl]methoxy]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one.
| Compound Name | (3S,3aS,9bR)-3,6,9-trimethyl-8-[[3-(4-phenylphenyl)triazol-4-yl]methoxy]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 71574527 |
| Molecular Formula | C30H29N3O3 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | (3S,3aS,9bR)-3,6,9-trimethyl-8-[[3-(4-phenylphenyl)triazol-4-yl]methoxy]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one |
| SMILES | Cc1cc(OCc2cnnn2-c2ccc(-c3ccccc3)cc2)c(C)c2c1CC[C@H]1[C@H](C)C(=O)O[C@@H]21 |
| InChI | InChI=1S/C30H29N3O3/c1-18-15-27(20(3)28-25(18)13-14-26-19(2)30(34)36-29(26)28)35-17-24-16-31-32-33(24)23-11-9-22(10-12-23)21-7-5-4-6-8-21/h4-12,15-16,19,26,29H,13-14,17H2,1-3H3/t19-,26-,29+/m0/s1 |
| InChIKey | MNPNEKCNYRULIR-ZTHLHLQVSA-N |
| XLogP | 5.93 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |