C29H29N3O4 — CID 71574528
(3S,3aS,9bR)-8-[[3-(6-methoxynaphthalen-2-yl)triazol-4-yl]methoxy]-3,6,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one (PubChem CID 71574528) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is (3S,3aS,9bR)-8-[[3-(6-methoxynaphthalen-2-yl)triazol-4-yl]methoxy]-3,6,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one.
| Compound Name | (3S,3aS,9bR)-8-[[3-(6-methoxynaphthalen-2-yl)triazol-4-yl]methoxy]-3,6,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 71574528 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | (3S,3aS,9bR)-8-[[3-(6-methoxynaphthalen-2-yl)triazol-4-yl]methoxy]-3,6,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one |
| SMILES | COc1ccc2cc(-n3nncc3COc3cc(C)c4c(c3C)[C@@H]3OC(=O)[C@@H](C)[C@@H]3CC4)ccc2c1 |
| InChI | InChI=1S/C29H29N3O4/c1-16-11-26(18(3)27-24(16)9-10-25-17(2)29(33)36-28(25)27)35-15-22-14-30-31-32(22)21-7-5-20-13-23(34-4)8-6-19(20)12-21/h5-8,11-14,17,25,28H,9-10,15H2,1-4H3/t17-,25-,28+/m0/s1 |
| InChIKey | PWVUDIUJDFTMTA-JGXREDOWSA-N |
| XLogP | 5.42 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |