C26H27N3O3 — CID 71574529
(3S,3aS,9bR)-3,6,9-trimethyl-8-[[3-[(E)-2-phenylethenyl]triazol-4-yl]methoxy]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one (PubChem CID 71574529) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is (3S,3aS,9bR)-3,6,9-trimethyl-8-[[3-[(E)-2-phenylethenyl]triazol-4-yl]methoxy]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one.
| Compound Name | (3S,3aS,9bR)-3,6,9-trimethyl-8-[[3-[(E)-2-phenylethenyl]triazol-4-yl]methoxy]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 71574529 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (3S,3aS,9bR)-3,6,9-trimethyl-8-[[3-[(E)-2-phenylethenyl]triazol-4-yl]methoxy]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one |
| SMILES | Cc1cc(OCc2cnnn2/C=C/c2ccccc2)c(C)c2c1CC[C@H]1[C@H](C)C(=O)O[C@@H]21 |
| InChI | InChI=1S/C26H27N3O3/c1-16-13-23(18(3)24-21(16)9-10-22-17(2)26(30)32-25(22)24)31-15-20-14-27-28-29(20)12-11-19-7-5-4-6-8-19/h4-8,11-14,17,22,25H,9-10,15H2,1-3H3/b12-11+/t17-,22-,25+/m0/s1 |
| InChIKey | VMFOPAUXTXNXDC-UNGKZGOGSA-N |
| XLogP | 4.90 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |