C24H19N5O2S — CID 71574591
3-[(5-anilino-1,3,4-thiadiazol-2-yl)methyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 71574591) has the molecular formula C24H19N5O2S and a molecular weight of 441.52 g/mol. Its IUPAC name is 3-[(5-anilino-1,3,4-thiadiazol-2-yl)methyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[(5-anilino-1,3,4-thiadiazol-2-yl)methyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71574591 |
| Molecular Formula | C24H19N5O2S |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 3-[(5-anilino-1,3,4-thiadiazol-2-yl)methyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1Cc1nnc(Nc2ccccc2)s1 |
| InChI | InChI=1S/C24H19N5O2S/c30-21-24(17-10-4-1-5-11-17,18-12-6-2-7-13-18)26-23(31)29(21)16-20-27-28-22(32-20)25-19-14-8-3-9-15-19/h1-15H,16H2,(H,25,28)(H,26,31) |
| InChIKey | GEYWKBYQSMNMTL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|