About dilithium;2-oxo-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioate
dilithium;2-oxo-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioate (PubChem CID 71574656) has the molecular formula C15H15Li2NO7
and a molecular weight of 335.17 g/mol. Its IUPAC name is dilithium;2-oxo-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioate.
Molecular Properties
| Compound Name | dilithium;2-oxo-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioate |
| PubChem CID | 71574656 |
| Molecular Formula | C15H15Li2NO7 |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | dilithium;2-oxo-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioate |
| SMILES | O=C(CCC(CC(=O)C(=O)[O-])C(=O)[O-])NOCc1ccccc1.[Li+].[Li+] |
| InChI | InChI=1S/C15H17NO7.2Li/c17-12(15(21)22)8-11(14(19)20)6-7-13(18)16-23-9-10-4-2-1-3-5-10;;/h1-5,11H,6-9H2,(H,16,18)(H,19,20)(H,21,22);;/q;2*+1/p-2 |
| InChIKey | GDXLSSXOYQVRQL-UHFFFAOYSA-L |
| XLogP | -7.90 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | -7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dilithium;2-oxo-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;2-oxo-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioate?
The IUPAC name of dilithium;2-oxo-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioate (CID 71574656) is dilithium;2-oxo-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioate.
What is the SMILES notation for dilithium;2-oxo-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioate?
The canonical SMILES for dilithium;2-oxo-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioate is O=C(CCC(CC(=O)C(=O)[O-])C(=O)[O-])NOCc1ccccc1.[Li+].[Li+].
What is the InChIKey of dilithium;2-oxo-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioate?
The InChIKey is GDXLSSXOYQVRQL-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H17NO7.2Li/c17-12(15(21)22)8-11(14(19)20)6-7-13(18)16-23-9-10-4-2-1-3-5-10;;/h1-5,11H,6-9H2,(H,16,18)(H,19,20)(H,21,22);;/q;2*+1/p-2.
What are the key properties of dilithium;2-oxo-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioate?
dilithium;2-oxo-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioate has a molecular weight of 335.17 g/mol, XLogP of -7.90, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;2-oxo-4-[3-oxo-3-(phenylmethoxyamino)propyl]pentanedioate is sourced from PubChem (CID 71574656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).