C20H19N5O2S — CID 71574679
3-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 71574679) has the molecular formula C20H19N5O2S and a molecular weight of 393.47 g/mol. Its IUPAC name is 3-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71574679 |
| Molecular Formula | C20H19N5O2S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 3-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | CCn1c(CN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)n[nH]c1=S |
| InChI | InChI=1S/C20H19N5O2S/c1-2-24-16(22-23-19(24)28)13-25-17(26)20(21-18(25)27,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3,(H,21,27)(H,23,28) |
| InChIKey | WOKYABKHURCERI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|