About 7-hexoxy-4,5-dihydroimidazo[1,2-a]quinoline
7-hexoxy-4,5-dihydroimidazo[1,2-a]quinoline (PubChem CID 71574715) has the molecular formula C17H22N2O
and a molecular weight of 270.38 g/mol. Its IUPAC name is 7-hexoxy-4,5-dihydroimidazo[1,2-a]quinoline.
Molecular Properties
| Compound Name | 7-hexoxy-4,5-dihydroimidazo[1,2-a]quinoline |
| PubChem CID | 71574715 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 7-hexoxy-4,5-dihydroimidazo[1,2-a]quinoline |
| SMILES | CCCCCCOc1ccc2c(c1)CCc1nccn1-2 |
| InChI | InChI=1S/C17H22N2O/c1-2-3-4-5-12-20-15-7-8-16-14(13-15)6-9-17-18-10-11-19(16)17/h7-8,10-11,13H,2-6,9,12H2,1H3 |
| InChIKey | BAQXXFKOZYOWMB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-hexoxy-4,5-dihydroimidazo[1,2-a]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hexoxy-4,5-dihydroimidazo[1,2-a]quinoline?
The IUPAC name of 7-hexoxy-4,5-dihydroimidazo[1,2-a]quinoline (CID 71574715) is 7-hexoxy-4,5-dihydroimidazo[1,2-a]quinoline.
What is the SMILES notation for 7-hexoxy-4,5-dihydroimidazo[1,2-a]quinoline?
The canonical SMILES for 7-hexoxy-4,5-dihydroimidazo[1,2-a]quinoline is CCCCCCOc1ccc2c(c1)CCc1nccn1-2.
What is the InChIKey of 7-hexoxy-4,5-dihydroimidazo[1,2-a]quinoline?
The InChIKey is BAQXXFKOZYOWMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O/c1-2-3-4-5-12-20-15-7-8-16-14(13-15)6-9-17-18-10-11-19(16)17/h7-8,10-11,13H,2-6,9,12H2,1H3.
What are the key properties of 7-hexoxy-4,5-dihydroimidazo[1,2-a]quinoline?
7-hexoxy-4,5-dihydroimidazo[1,2-a]quinoline has a molecular weight of 270.38 g/mol, XLogP of 3.93, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hexoxy-4,5-dihydroimidazo[1,2-a]quinoline is sourced from PubChem (CID 71574715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).