About [1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol
[1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol (PubChem CID 71575014) has the molecular formula C19H22N2O2
and a molecular weight of 310.40 g/mol. Its IUPAC name is [1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol.
Molecular Properties
| Compound Name | [1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol |
| PubChem CID | 71575014 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | [1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol |
| SMILES | CCc1c(CO)c(CO)c2n1Cc1c(c3ccccc3n1C)C2 |
| InChI | InChI=1S/C19H22N2O2/c1-3-16-14(10-22)15(11-23)18-8-13-12-6-4-5-7-17(12)20(2)19(13)9-21(16)18/h4-7,22-23H,3,8-11H2,1-2H3 |
| InChIKey | MDIFAFOXEZRNAX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze [1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol?
The IUPAC name of [1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol (CID 71575014) is [1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol.
What is the SMILES notation for [1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol?
The canonical SMILES for [1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol is CCc1c(CO)c(CO)c2n1Cc1c(c3ccccc3n1C)C2.
What is the InChIKey of [1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol?
The InChIKey is MDIFAFOXEZRNAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O2/c1-3-16-14(10-22)15(11-23)18-8-13-12-6-4-5-7-17(12)20(2)19(13)9-21(16)18/h4-7,22-23H,3,8-11H2,1-2H3.
What are the key properties of [1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol?
[1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol has a molecular weight of 310.40 g/mol, XLogP of 2.48, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol is sourced from PubChem (CID 71575014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).