C19H22N2O2 — CID 71575014
[1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol (PubChem CID 71575014) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is [1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol.
| Compound Name | [1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol |
|---|---|
| PubChem CID | 71575014 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | [1-ethyl-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol |
| SMILES | CCc1c(CO)c(CO)c2n1Cc1c(c3ccccc3n1C)C2 |
| InChI | InChI=1S/C19H22N2O2/c1-3-16-14(10-22)15(11-23)18-8-13-12-6-4-5-7-17(12)20(2)19(13)9-21(16)18/h4-7,22-23H,3,8-11H2,1-2H3 |
| InChIKey | MDIFAFOXEZRNAX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|