C25H26N2O4 — CID 71575108
[1-(3,4-dimethoxyphenyl)-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol (PubChem CID 71575108) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is [1-(3,4-dimethoxyphenyl)-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol.
| Compound Name | [1-(3,4-dimethoxyphenyl)-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol |
|---|---|
| PubChem CID | 71575108 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | [1-(3,4-dimethoxyphenyl)-2-(hydroxymethyl)-9-methyl-4,10-dihydroindolizino[6,7-b]indol-3-yl]methanol |
| SMILES | COc1ccc(-c2c(CO)c(CO)c3n2Cc2c(c4ccccc4n2C)C3)cc1OC |
| InChI | InChI=1S/C25H26N2O4/c1-26-20-7-5-4-6-16(20)17-11-21-18(13-28)19(14-29)25(27(21)12-22(17)26)15-8-9-23(30-2)24(10-15)31-3/h4-10,28-29H,11-14H2,1-3H3 |
| InChIKey | WJJJVVPXOIWXAY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|