About 1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea
1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 71575215) has the molecular formula C20H15F3N6O2
and a molecular weight of 428.37 g/mol. Its IUPAC name is 1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea.
Molecular Properties
| Compound Name | 1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea |
| PubChem CID | 71575215 |
| Molecular Formula | C20H15F3N6O2 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | Cn1ncc2c(Oc3ccc(NC(=O)Nc4ccc(C(F)(F)F)cc4)cc3)ncnc21 |
| InChI | InChI=1S/C20H15F3N6O2/c1-29-17-16(10-26-29)18(25-11-24-17)31-15-8-6-14(7-9-15)28-19(30)27-13-4-2-12(3-5-13)20(21,22)23/h2-11H,1H3,(H2,27,28,30) |
| InChIKey | JIWVARRTFYLYOQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea?
The IUPAC name of 1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea (CID 71575215) is 1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea.
What is the SMILES notation for 1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea?
The canonical SMILES for 1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea is Cn1ncc2c(Oc3ccc(NC(=O)Nc4ccc(C(F)(F)F)cc4)cc3)ncnc21.
What is the InChIKey of 1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea?
The InChIKey is JIWVARRTFYLYOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F3N6O2/c1-29-17-16(10-26-29)18(25-11-24-17)31-15-8-6-14(7-9-15)28-19(30)27-13-4-2-12(3-5-13)20(21,22)23/h2-11H,1H3,(H2,27,28,30).
What are the key properties of 1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea?
1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea has a molecular weight of 428.37 g/mol, XLogP of 4.82, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea is sourced from PubChem (CID 71575215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).