About N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-yloxy)phenyl]-4-(trifluoromethyl)benzamide
N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-yloxy)phenyl]-4-(trifluoromethyl)benzamide (PubChem CID 71575326) has the molecular formula C19H12F3N5O2
and a molecular weight of 399.33 g/mol. Its IUPAC name is N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-yloxy)phenyl]-4-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-yloxy)phenyl]-4-(trifluoromethyl)benzamide |
| PubChem CID | 71575326 |
| Molecular Formula | C19H12F3N5O2 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-yloxy)phenyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cccc(Oc2ncnc3[nH]ncc23)c1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H12F3N5O2/c20-19(21,22)12-6-4-11(5-7-12)17(28)26-13-2-1-3-14(8-13)29-18-15-9-25-27-16(15)23-10-24-18/h1-10H,(H,26,28)(H,23,24,25,27) |
| InChIKey | RIGIEHDTVCPMDK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-yloxy)phenyl]-4-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-yloxy)phenyl]-4-(trifluoromethyl)benzamide?
The IUPAC name of N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-yloxy)phenyl]-4-(trifluoromethyl)benzamide (CID 71575326) is N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-yloxy)phenyl]-4-(trifluoromethyl)benzamide.
What is the SMILES notation for N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-yloxy)phenyl]-4-(trifluoromethyl)benzamide?
The canonical SMILES for N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-yloxy)phenyl]-4-(trifluoromethyl)benzamide is O=C(Nc1cccc(Oc2ncnc3[nH]ncc23)c1)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-yloxy)phenyl]-4-(trifluoromethyl)benzamide?
The InChIKey is RIGIEHDTVCPMDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F3N5O2/c20-19(21,22)12-6-4-11(5-7-12)17(28)26-13-2-1-3-14(8-13)29-18-15-9-25-27-16(15)23-10-24-18/h1-10H,(H,26,28)(H,23,24,25,27).
What are the key properties of N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-yloxy)phenyl]-4-(trifluoromethyl)benzamide?
N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-yloxy)phenyl]-4-(trifluoromethyl)benzamide has a molecular weight of 399.33 g/mol, XLogP of 4.42, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-yloxy)phenyl]-4-(trifluoromethyl)benzamide is sourced from PubChem (CID 71575326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).