C31H34F3N5O2 — CID 71575461
1-[3-[4-[3-(cyclohexylamino)-6-methylimidazo[1,2-a]pyridin-2-yl]phenoxy]propyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 71575461) has the molecular formula C31H34F3N5O2 and a molecular weight of 565.64 g/mol. Its IUPAC name is 1-[3-[4-[3-(cyclohexylamino)-6-methylimidazo[1,2-a]pyridin-2-yl]phenoxy]propyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[4-[3-(cyclohexylamino)-6-methylimidazo[1,2-a]pyridin-2-yl]phenoxy]propyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 71575461 |
| Molecular Formula | C31H34F3N5O2 |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | 1-[3-[4-[3-(cyclohexylamino)-6-methylimidazo[1,2-a]pyridin-2-yl]phenoxy]propyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1ccc2nc(-c3ccc(OCCCNC(=O)Nc4ccc(C(F)(F)F)cc4)cc3)c(NC3CCCCC3)n2c1 |
| InChI | InChI=1S/C31H34F3N5O2/c1-21-8-17-27-38-28(29(39(27)20-21)36-24-6-3-2-4-7-24)22-9-15-26(16-10-22)41-19-5-18-35-30(40)37-25-13-11-23(12-14-25)31(32,33)34/h8-17,20,24,36H,2-7,18-19H2,1H3,(H2,35,37,40) |
| InChIKey | KJMDNHZVPHKCMK-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 79.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|