About prop-2-enyl (3S)-2-oxo-3-[(1R)-1-(2-phenylmethoxyacetyl)oxyethyl]azetidine-1-carboxylate
prop-2-enyl (3S)-2-oxo-3-[(1R)-1-(2-phenylmethoxyacetyl)oxyethyl]azetidine-1-carboxylate (PubChem CID 71575480) has the molecular formula C18H21NO6
and a molecular weight of 347.37 g/mol. Its IUPAC name is prop-2-enyl (3S)-2-oxo-3-[(1R)-1-(2-phenylmethoxyacetyl)oxyethyl]azetidine-1-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl (3S)-2-oxo-3-[(1R)-1-(2-phenylmethoxyacetyl)oxyethyl]azetidine-1-carboxylate |
| PubChem CID | 71575480 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | prop-2-enyl (3S)-2-oxo-3-[(1R)-1-(2-phenylmethoxyacetyl)oxyethyl]azetidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H]([C@@H](C)OC(=O)COCc2ccccc2)C1=O |
| InChI | InChI=1S/C18H21NO6/c1-3-9-24-18(22)19-10-15(17(19)21)13(2)25-16(20)12-23-11-14-7-5-4-6-8-14/h3-8,13,15H,1,9-12H2,2H3/t13-,15+/m1/s1 |
| InChIKey | TYTDTDTVRLSINR-HIFRSBDPSA-N |
| XLogP | 1.92 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl (3S)-2-oxo-3-[(1R)-1-(2-phenylmethoxyacetyl)oxyethyl]azetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl (3S)-2-oxo-3-[(1R)-1-(2-phenylmethoxyacetyl)oxyethyl]azetidine-1-carboxylate?
The IUPAC name of prop-2-enyl (3S)-2-oxo-3-[(1R)-1-(2-phenylmethoxyacetyl)oxyethyl]azetidine-1-carboxylate (CID 71575480) is prop-2-enyl (3S)-2-oxo-3-[(1R)-1-(2-phenylmethoxyacetyl)oxyethyl]azetidine-1-carboxylate.
What is the SMILES notation for prop-2-enyl (3S)-2-oxo-3-[(1R)-1-(2-phenylmethoxyacetyl)oxyethyl]azetidine-1-carboxylate?
The canonical SMILES for prop-2-enyl (3S)-2-oxo-3-[(1R)-1-(2-phenylmethoxyacetyl)oxyethyl]azetidine-1-carboxylate is C=CCOC(=O)N1C[C@@H]([C@@H](C)OC(=O)COCc2ccccc2)C1=O.
What is the InChIKey of prop-2-enyl (3S)-2-oxo-3-[(1R)-1-(2-phenylmethoxyacetyl)oxyethyl]azetidine-1-carboxylate?
The InChIKey is TYTDTDTVRLSINR-HIFRSBDPSA-N. The full InChI is InChI=1S/C18H21NO6/c1-3-9-24-18(22)19-10-15(17(19)21)13(2)25-16(20)12-23-11-14-7-5-4-6-8-14/h3-8,13,15H,1,9-12H2,2H3/t13-,15+/m1/s1.
What are the key properties of prop-2-enyl (3S)-2-oxo-3-[(1R)-1-(2-phenylmethoxyacetyl)oxyethyl]azetidine-1-carboxylate?
prop-2-enyl (3S)-2-oxo-3-[(1R)-1-(2-phenylmethoxyacetyl)oxyethyl]azetidine-1-carboxylate has a molecular weight of 347.37 g/mol, XLogP of 1.92, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl (3S)-2-oxo-3-[(1R)-1-(2-phenylmethoxyacetyl)oxyethyl]azetidine-1-carboxylate is sourced from PubChem (CID 71575480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).