C21H26N4O5S2 — CID 71575733
1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]butan-1-one (PubChem CID 71575733) has the molecular formula C21H26N4O5S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]butan-1-one.
| Compound Name | 1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 71575733 |
| Molecular Formula | C21H26N4O5S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]butan-1-one |
| SMILES | CCC(C(=O)N1CCc2sccc2C1)N1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C21H26N4O5S2/c1-2-19(21(26)23-9-7-20-16(15-23)8-14-31-20)22-10-12-24(13-11-22)32(29,30)18-5-3-17(4-6-18)25(27)28/h3-6,8,14,19H,2,7,9-13,15H2,1H3 |
| InChIKey | AFUSXJJDQXPDGN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|