C29H20BCl3F5N3O4 — CID 71575781
N-[[3,3-bis(fluoromethyl)-1-hydroxy-2,1-benzoxaborol-6-yl]methyl]-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-8-carboxamide (PubChem CID 71575781) has the molecular formula C29H20BCl3F5N3O4 and a molecular weight of 686.66 g/mol. Its IUPAC name is N-[[3,3-bis(fluoromethyl)-1-hydroxy-2,1-benzoxaborol-6-yl]methyl]-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-8-carboxamide.
| Compound Name | N-[[3,3-bis(fluoromethyl)-1-hydroxy-2,1-benzoxaborol-6-yl]methyl]-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-8-carboxamide |
|---|---|
| PubChem CID | 71575781 |
| Molecular Formula | C29H20BCl3F5N3O4 |
| Molecular Weight | 686.66 g/mol |
| Exact Mass | 685.05 |
| IUPAC Name | N-[[3,3-bis(fluoromethyl)-1-hydroxy-2,1-benzoxaborol-6-yl]methyl]-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-8-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)B(O)OC2(CF)CF)c1ccc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)n2cccc12 |
| InChI | InChI=1S/C29H20BCl3F5N3O4/c31-20-9-16(10-21(32)25(20)33)28(29(36,37)38)11-22(40-45-28)24-6-4-17(23-2-1-7-41(23)24)26(42)39-12-15-3-5-18-19(8-15)30(43)44-27(18,13-34)14-35/h1-10,43H,11-14H2,(H,39,42) |
| InChIKey | RSWJYSNWAVDKOS-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.66 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|