About N,N-dimethyl-N'-propyl-N'-pyridin-2-ylethane-1,2-diamine
N,N-dimethyl-N'-propyl-N'-pyridin-2-ylethane-1,2-diamine (PubChem CID 71575785) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is N,N-dimethyl-N'-propyl-N'-pyridin-2-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N,N-dimethyl-N'-propyl-N'-pyridin-2-ylethane-1,2-diamine |
| PubChem CID | 71575785 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | N,N-dimethyl-N'-propyl-N'-pyridin-2-ylethane-1,2-diamine |
| SMILES | CCCN(CCN(C)C)c1ccccn1 |
| InChI | InChI=1S/C12H21N3/c1-4-9-15(11-10-14(2)3)12-7-5-6-8-13-12/h5-8H,4,9-11H2,1-3H3 |
| InChIKey | RFBBAIPIHLYHLB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethyl-N'-propyl-N'-pyridin-2-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-N'-propyl-N'-pyridin-2-ylethane-1,2-diamine?
The IUPAC name of N,N-dimethyl-N'-propyl-N'-pyridin-2-ylethane-1,2-diamine (CID 71575785) is N,N-dimethyl-N'-propyl-N'-pyridin-2-ylethane-1,2-diamine.
What is the SMILES notation for N,N-dimethyl-N'-propyl-N'-pyridin-2-ylethane-1,2-diamine?
The canonical SMILES for N,N-dimethyl-N'-propyl-N'-pyridin-2-ylethane-1,2-diamine is CCCN(CCN(C)C)c1ccccn1.
What is the InChIKey of N,N-dimethyl-N'-propyl-N'-pyridin-2-ylethane-1,2-diamine?
The InChIKey is RFBBAIPIHLYHLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3/c1-4-9-15(11-10-14(2)3)12-7-5-6-8-13-12/h5-8H,4,9-11H2,1-3H3.
What are the key properties of N,N-dimethyl-N'-propyl-N'-pyridin-2-ylethane-1,2-diamine?
N,N-dimethyl-N'-propyl-N'-pyridin-2-ylethane-1,2-diamine has a molecular weight of 207.32 g/mol, XLogP of 1.86, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-N'-propyl-N'-pyridin-2-ylethane-1,2-diamine is sourced from PubChem (CID 71575785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).