C31H24BCl3F3N3O4 — CID 71575831
N-[(1-hydroxyspiro[2,1-benzoxaborole-3,1'-cyclopentane]-6-yl)methyl]-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-8-carboxamide (PubChem CID 71575831) has the molecular formula C31H24BCl3F3N3O4 and a molecular weight of 676.72 g/mol. Its IUPAC name is N-[(1-hydroxyspiro[2,1-benzoxaborole-3,1'-cyclopentane]-6-yl)methyl]-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-8-carboxamide.
| Compound Name | N-[(1-hydroxyspiro[2,1-benzoxaborole-3,1'-cyclopentane]-6-yl)methyl]-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-8-carboxamide |
|---|---|
| PubChem CID | 71575831 |
| Molecular Formula | C31H24BCl3F3N3O4 |
| Molecular Weight | 676.72 g/mol |
| Exact Mass | 675.09 |
| IUPAC Name | N-[(1-hydroxyspiro[2,1-benzoxaborole-3,1'-cyclopentane]-6-yl)methyl]-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-8-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)B(O)OC21CCCC1)c1ccc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)n2cccc12 |
| InChI | InChI=1S/C31H24BCl3F3N3O4/c33-22-13-18(14-23(34)27(22)35)30(31(36,37)38)15-24(40-45-30)26-8-6-19(25-4-3-11-41(25)26)28(42)39-16-17-5-7-20-21(12-17)32(43)44-29(20)9-1-2-10-29/h3-8,11-14,43H,1-2,9-10,15-16H2,(H,39,42) |
| InChIKey | BCZXLWVFYWGRAH-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.72 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|