C30H24BCl3F3N3O4 — CID 71575832
N-[2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethyl]-8-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-5-carboxamide (PubChem CID 71575832) has the molecular formula C30H24BCl3F3N3O4 and a molecular weight of 664.70 g/mol. Its IUPAC name is N-[2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethyl]-8-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-5-carboxamide.
| Compound Name | N-[2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethyl]-8-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-5-carboxamide |
|---|---|
| PubChem CID | 71575832 |
| Molecular Formula | C30H24BCl3F3N3O4 |
| Molecular Weight | 664.70 g/mol |
| Exact Mass | 663.09 |
| IUPAC Name | N-[2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethyl]-8-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-5-carboxamide |
| SMILES | CC1(C)OB(O)c2cc(CCNC(=O)c3ccc(C4=NOC(c5cc(Cl)c(Cl)c(Cl)c5)(C(F)(F)F)C4)c4cccn34)ccc21 |
| InChI | InChI=1S/C30H24BCl3F3N3O4/c1-28(2)19-7-5-16(12-20(19)31(42)43-28)9-10-38-27(41)25-8-6-18(24-4-3-11-40(24)25)23-15-29(44-39-23,30(35,36)37)17-13-21(32)26(34)22(33)14-17/h3-8,11-14,42H,9-10,15H2,1-2H3,(H,38,41) |
| InChIKey | QLJYPHJKFJKLPF-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.70 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|