C31H26BCl3F3N3O4 — CID 71575949
N-[2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)propan-2-yl]-8-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-5-carboxamide (PubChem CID 71575949) has the molecular formula C31H26BCl3F3N3O4 and a molecular weight of 678.73 g/mol. Its IUPAC name is N-[2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)propan-2-yl]-8-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-5-carboxamide.
| Compound Name | N-[2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)propan-2-yl]-8-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-5-carboxamide |
|---|---|
| PubChem CID | 71575949 |
| Molecular Formula | C31H26BCl3F3N3O4 |
| Molecular Weight | 678.73 g/mol |
| Exact Mass | 677.10 |
| IUPAC Name | N-[2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)propan-2-yl]-8-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-5-carboxamide |
| SMILES | CC(C)(NC(=O)c1ccc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)c2cccn12)c1ccc2c(c1)B(O)OC2(C)C |
| InChI | InChI=1S/C31H26BCl3F3N3O4/c1-28(2,16-7-9-19-20(12-16)32(43)44-29(19,3)4)39-27(42)25-10-8-18(24-6-5-11-41(24)25)23-15-30(45-40-23,31(36,37)38)17-13-21(33)26(35)22(34)14-17/h5-14,43H,15H2,1-4H3,(H,39,42) |
| InChIKey | ADVLWEZOCAVXPX-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.73 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|