C18H19N2O4S- — CID 7157597
(1S,6R)-6-[(6-ethoxy-1,3-benzothiazol-2-yl)carbamoyl]-4-methylcyclohex-3-ene-1-carboxylate (PubChem CID 7157597) has the molecular formula C18H19N2O4S- and a molecular weight of 359.43 g/mol. Its IUPAC name is (1S,6R)-6-[(6-ethoxy-1,3-benzothiazol-2-yl)carbamoyl]-4-methylcyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6R)-6-[(6-ethoxy-1,3-benzothiazol-2-yl)carbamoyl]-4-methylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7157597 |
| Molecular Formula | C18H19N2O4S- |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | (1S,6R)-6-[(6-ethoxy-1,3-benzothiazol-2-yl)carbamoyl]-4-methylcyclohex-3-ene-1-carboxylate |
| SMILES | CCOc1ccc2nc(NC(=O)[C@@H]3CC(C)=CC[C@@H]3C(=O)[O-])sc2c1 |
| InChI | InChI=1S/C18H20N2O4S/c1-3-24-11-5-7-14-15(9-11)25-18(19-14)20-16(21)13-8-10(2)4-6-12(13)17(22)23/h4-5,7,9,12-13H,3,6,8H2,1-2H3,(H,22,23)(H,19,20,21)/p-1/t12-,13+/m0/s1 |
| InChIKey | XZUYZIXPQIPGSG-QWHCGFSZSA-M |
| XLogP | 2.36 |
| TPSA | 91.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|