C24H22FN5OS — CID 71576126
4-[4-[[(2S)-2-amino-3-phenylpropyl]amino]-2-(3-fluoro-4-pyridinyl)thieno[3,2-d]pyrimidin-7-yl]but-3-yn-1-ol (PubChem CID 71576126) has the molecular formula C24H22FN5OS and a molecular weight of 447.54 g/mol. Its IUPAC name is 4-[4-[[(2S)-2-amino-3-phenylpropyl]amino]-2-(3-fluoro-4-pyridinyl)thieno[3,2-d]pyrimidin-7-yl]but-3-yn-1-ol.
| Compound Name | 4-[4-[[(2S)-2-amino-3-phenylpropyl]amino]-2-(3-fluoro-4-pyridinyl)thieno[3,2-d]pyrimidin-7-yl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 71576126 |
| Molecular Formula | C24H22FN5OS |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 4-[4-[[(2S)-2-amino-3-phenylpropyl]amino]-2-(3-fluoro-4-pyridinyl)thieno[3,2-d]pyrimidin-7-yl]but-3-yn-1-ol |
| SMILES | N[C@H](CNc1nc(-c2ccncc2F)nc2c(C#CCCO)csc12)Cc1ccccc1 |
| InChI | InChI=1S/C24H22FN5OS/c25-20-14-27-10-9-19(20)23-29-21-17(8-4-5-11-31)15-32-22(21)24(30-23)28-13-18(26)12-16-6-2-1-3-7-16/h1-3,6-7,9-10,14-15,18,31H,5,11-13,26H2,(H,28,29,30)/t18-/m0/s1 |
| InChIKey | SUDAMNSWCGEVTD-SFHVURJKSA-N |
| XLogP | 3.61 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|