About 5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-2-ethyltriazolo[4,5-d]pyrimidine
5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-2-ethyltriazolo[4,5-d]pyrimidine (PubChem CID 71576307) has the molecular formula C14H20F2N6
and a molecular weight of 310.35 g/mol. Its IUPAC name is 5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-2-ethyltriazolo[4,5-d]pyrimidine.
Molecular Properties
| Compound Name | 5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-2-ethyltriazolo[4,5-d]pyrimidine |
| PubChem CID | 71576307 |
| Molecular Formula | C14H20F2N6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-2-ethyltriazolo[4,5-d]pyrimidine |
| SMILES | CCn1nc2nc(C(C)(C)C)nc(N3CCC(F)(F)C3)c2n1 |
| InChI | InChI=1S/C14H20F2N6/c1-5-22-19-9-10(20-22)17-12(13(2,3)4)18-11(9)21-7-6-14(15,16)8-21/h5-8H2,1-4H3 |
| InChIKey | NZUHBNIGASZERO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-2-ethyltriazolo[4,5-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-2-ethyltriazolo[4,5-d]pyrimidine?
The IUPAC name of 5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-2-ethyltriazolo[4,5-d]pyrimidine (CID 71576307) is 5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-2-ethyltriazolo[4,5-d]pyrimidine.
What is the SMILES notation for 5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-2-ethyltriazolo[4,5-d]pyrimidine?
The canonical SMILES for 5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-2-ethyltriazolo[4,5-d]pyrimidine is CCn1nc2nc(C(C)(C)C)nc(N3CCC(F)(F)C3)c2n1.
What is the InChIKey of 5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-2-ethyltriazolo[4,5-d]pyrimidine?
The InChIKey is NZUHBNIGASZERO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2N6/c1-5-22-19-9-10(20-22)17-12(13(2,3)4)18-11(9)21-7-6-14(15,16)8-21/h5-8H2,1-4H3.
What are the key properties of 5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-2-ethyltriazolo[4,5-d]pyrimidine?
5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-2-ethyltriazolo[4,5-d]pyrimidine has a molecular weight of 310.35 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-2-ethyltriazolo[4,5-d]pyrimidine is sourced from PubChem (CID 71576307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).