C29H22BCl3F3N3O4 — CID 71576341
N-[(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)methyl]-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-8-carboxamide (PubChem CID 71576341) has the molecular formula C29H22BCl3F3N3O4 and a molecular weight of 650.68 g/mol. Its IUPAC name is N-[(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)methyl]-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-8-carboxamide.
| Compound Name | N-[(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)methyl]-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-8-carboxamide |
|---|---|
| PubChem CID | 71576341 |
| Molecular Formula | C29H22BCl3F3N3O4 |
| Molecular Weight | 650.68 g/mol |
| Exact Mass | 649.07 |
| IUPAC Name | N-[(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)methyl]-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-8-carboxamide |
| SMILES | CC1(C)OB(O)c2cc(CNC(=O)c3ccc(C4=NOC(c5cc(Cl)c(Cl)c(Cl)c5)(C(F)(F)F)C4)n4cccc34)ccc21 |
| InChI | InChI=1S/C29H22BCl3F3N3O4/c1-27(2)18-7-5-15(10-19(18)30(41)42-27)14-37-26(40)17-6-8-24(39-9-3-4-23(17)39)22-13-28(43-38-22,29(34,35)36)16-11-20(31)25(33)21(32)12-16/h3-12,41H,13-14H2,1-2H3,(H,37,40) |
| InChIKey | ASTKNRUHFMXNAQ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.68 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|