C18H25N7O4 — CID 71576429
2-amino-N-[(2S,3S,4R,5R)-5-[6-(dimethylamino)purin-9-yl]-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]hex-5-ynamide (PubChem CID 71576429) has the molecular formula C18H25N7O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-amino-N-[(2S,3S,4R,5R)-5-[6-(dimethylamino)purin-9-yl]-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]hex-5-ynamide.
| Compound Name | 2-amino-N-[(2S,3S,4R,5R)-5-[6-(dimethylamino)purin-9-yl]-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]hex-5-ynamide |
|---|---|
| PubChem CID | 71576429 |
| Molecular Formula | C18H25N7O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 2-amino-N-[(2S,3S,4R,5R)-5-[6-(dimethylamino)purin-9-yl]-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]hex-5-ynamide |
| SMILES | C#CCCC(N)C(=O)N[C@H]1[C@@H](O)[C@H](n2cnc3c(N(C)C)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C18H25N7O4/c1-4-5-6-10(19)17(28)23-12-11(7-26)29-18(14(12)27)25-9-22-13-15(24(2)3)20-8-21-16(13)25/h1,8-12,14,18,26-27H,5-7,19H2,2-3H3,(H,23,28)/t10?,11-,12-,14-,18-/m1/s1 |
| InChIKey | PGZCIYZMCUWHSD-BDALGOTKSA-N |
| XLogP | -1.63 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|