C43H64N2O4 — CID 71576591
2-(4-benzoylpiperazin-1-yl)ethyl 10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate (PubChem CID 71576591) has the molecular formula C43H64N2O4 and a molecular weight of 673.00 g/mol. Its IUPAC name is 2-(4-benzoylpiperazin-1-yl)ethyl 10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate.
| Compound Name | 2-(4-benzoylpiperazin-1-yl)ethyl 10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 71576591 |
| Molecular Formula | C43H64N2O4 |
| Molecular Weight | 673.00 g/mol |
| Exact Mass | 672.49 |
| IUPAC Name | 2-(4-benzoylpiperazin-1-yl)ethyl 10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
| SMILES | CC1CCC2(C(=O)OCCN3CCN(C(=O)c4ccccc4)CC3)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C |
| InChI | InChI=1S/C43H64N2O4/c1-29-15-20-43(38(48)49-28-27-44-23-25-45(26-24-44)37(47)31-11-9-8-10-12-31)22-21-41(6)32(36(43)30(29)2)13-14-34-40(5)18-17-35(46)39(3,4)33(40)16-19-42(34,41)7/h8-13,29-30,33-36,46H,14-28H2,1-7H3 |
| InChIKey | ODKBMKBRBIRTKD-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.00 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|