C30H42N8O6 — CID 71576836
methyl (3R,9S,12S,15S)-12-benzyl-3-[[(2S)-2-(methylamino)propanoyl]amino]-4,10,13-trioxo-5,11,14,20,21,22-hexazatricyclo[18.2.1.05,9]tricosa-1(23),21-diene-15-carboxylate (PubChem CID 71576836) has the molecular formula C30H42N8O6 and a molecular weight of 610.72 g/mol. Its IUPAC name is methyl (3R,9S,12S,15S)-12-benzyl-3-[[(2S)-2-(methylamino)propanoyl]amino]-4,10,13-trioxo-5,11,14,20,21,22-hexazatricyclo[18.2.1.05,9]tricosa-1(23),21-diene-15-carboxylate.
| Compound Name | methyl (3R,9S,12S,15S)-12-benzyl-3-[[(2S)-2-(methylamino)propanoyl]amino]-4,10,13-trioxo-5,11,14,20,21,22-hexazatricyclo[18.2.1.05,9]tricosa-1(23),21-diene-15-carboxylate |
|---|---|
| PubChem CID | 71576836 |
| Molecular Formula | C30H42N8O6 |
| Molecular Weight | 610.72 g/mol |
| Exact Mass | 610.32 |
| IUPAC Name | methyl (3R,9S,12S,15S)-12-benzyl-3-[[(2S)-2-(methylamino)propanoyl]amino]-4,10,13-trioxo-5,11,14,20,21,22-hexazatricyclo[18.2.1.05,9]tricosa-1(23),21-diene-15-carboxylate |
| SMILES | CN[C@@H](C)C(=O)N[C@@H]1Cc2cn(nn2)CCCC[C@@H](C(=O)OC)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C30H42N8O6/c1-19(31-2)26(39)34-24-17-21-18-37(36-35-21)14-8-7-12-22(30(43)44-3)32-27(40)23(16-20-10-5-4-6-11-20)33-28(41)25-13-9-15-38(25)29(24)42/h4-6,10-11,18-19,22-25,31H,7-9,12-17H2,1-3H3,(H,32,40)(H,33,41)(H,34,39)/t19-,22-,23-,24+,25-/m0/s1 |
| InChIKey | NMSASYDXOJUOCO-FTSNLURZSA-N |
| XLogP | -0.53 |
| TPSA | 176.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.72 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |