C28H26F6N4OS — CID 71577290
1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-hydroxymethyl]quinolin-6-yl]thiourea (PubChem CID 71577290) has the molecular formula C28H26F6N4OS and a molecular weight of 580.60 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-hydroxymethyl]quinolin-6-yl]thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-hydroxymethyl]quinolin-6-yl]thiourea |
|---|---|
| PubChem CID | 71577290 |
| Molecular Formula | C28H26F6N4OS |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-hydroxymethyl]quinolin-6-yl]thiourea |
| SMILES | C=CC1CN2CCC1CC2C(O)c1ccnc2ccc(NC(=S)Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C28H26F6N4OS/c1-2-15-14-38-8-6-16(15)9-24(38)25(39)21-5-7-35-23-4-3-19(13-22(21)23)36-26(40)37-20-11-17(27(29,30)31)10-18(12-20)28(32,33)34/h2-5,7,10-13,15-16,24-25,39H,1,6,8-9,14H2,(H2,36,37,40) |
| InChIKey | VEMWSEYGQMGSAS-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|