C29H26F6N6O4S — CID 71577427
N-[6-[4-[5-[[2-[3-(2,2,2-trifluoroethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide (PubChem CID 71577427) has the molecular formula C29H26F6N6O4S and a molecular weight of 668.62 g/mol. Its IUPAC name is N-[6-[4-[5-[[2-[3-(2,2,2-trifluoroethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[6-[4-[5-[[2-[3-(2,2,2-trifluoroethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 71577427 |
| Molecular Formula | C29H26F6N6O4S |
| Molecular Weight | 668.62 g/mol |
| Exact Mass | 668.16 |
| IUPAC Name | N-[6-[4-[5-[[2-[3-(2,2,2-trifluoroethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(Cc1cccc(OC(F)(F)F)c1)Nc1ccc(CCCCc2nnc(NC(=O)Cc3cccc(OCC(F)(F)F)c3)s2)nn1 |
| InChI | InChI=1S/C29H26F6N6O4S/c30-28(31,32)17-44-21-8-3-5-18(13-21)16-25(43)37-27-41-40-26(46-27)10-2-1-7-20-11-12-23(39-38-20)36-24(42)15-19-6-4-9-22(14-19)45-29(33,34)35/h3-6,8-9,11-14H,1-2,7,10,15-17H2,(H,36,39,42)(H,37,41,43) |
| InChIKey | OOQPQPACUZLVEV-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|