About 2-(dimethylamino)ethyl 5-methoxy-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate
2-(dimethylamino)ethyl 5-methoxy-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate (PubChem CID 71577435) has the molecular formula C17H22N2O5
and a molecular weight of 334.37 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 5-methoxy-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 5-methoxy-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate |
| PubChem CID | 71577435 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-(dimethylamino)ethyl 5-methoxy-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate |
| SMILES | COC(=O)Cn1c(C(=O)OCCN(C)C)cc2cc(OC)ccc21 |
| InChI | InChI=1S/C17H22N2O5/c1-18(2)7-8-24-17(21)15-10-12-9-13(22-3)5-6-14(12)19(15)11-16(20)23-4/h5-6,9-10H,7-8,11H2,1-4H3 |
| InChIKey | QEPUZBRAWIHFAL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(dimethylamino)ethyl 5-methoxy-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 5-methoxy-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate?
The IUPAC name of 2-(dimethylamino)ethyl 5-methoxy-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate (CID 71577435) is 2-(dimethylamino)ethyl 5-methoxy-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate.
What is the SMILES notation for 2-(dimethylamino)ethyl 5-methoxy-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate?
The canonical SMILES for 2-(dimethylamino)ethyl 5-methoxy-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate is COC(=O)Cn1c(C(=O)OCCN(C)C)cc2cc(OC)ccc21.
What is the InChIKey of 2-(dimethylamino)ethyl 5-methoxy-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate?
The InChIKey is QEPUZBRAWIHFAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O5/c1-18(2)7-8-24-17(21)15-10-12-9-13(22-3)5-6-14(12)19(15)11-16(20)23-4/h5-6,9-10H,7-8,11H2,1-4H3.
What are the key properties of 2-(dimethylamino)ethyl 5-methoxy-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate?
2-(dimethylamino)ethyl 5-methoxy-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate has a molecular weight of 334.37 g/mol, XLogP of 1.54, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 5-methoxy-1-(2-methoxy-2-oxoethyl)indole-2-carboxylate is sourced from PubChem (CID 71577435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).