C25H36O9 — CID 71577599
[(1R,2R,4R,6S,8S,9S,10S,11S,13S,14S)-8-acetyloxy-2,6-dihydroxy-14-(methoxymethyl)-5,5,9-trimethyl-3,15-dioxo-11-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate (PubChem CID 71577599) has the molecular formula C25H36O9 and a molecular weight of 480.55 g/mol. Its IUPAC name is [(1R,2R,4R,6S,8S,9S,10S,11S,13S,14S)-8-acetyloxy-2,6-dihydroxy-14-(methoxymethyl)-5,5,9-trimethyl-3,15-dioxo-11-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate.
| Compound Name | [(1R,2R,4R,6S,8S,9S,10S,11S,13S,14S)-8-acetyloxy-2,6-dihydroxy-14-(methoxymethyl)-5,5,9-trimethyl-3,15-dioxo-11-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
|---|---|
| PubChem CID | 71577599 |
| Molecular Formula | C25H36O9 |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | [(1R,2R,4R,6S,8S,9S,10S,11S,13S,14S)-8-acetyloxy-2,6-dihydroxy-14-(methoxymethyl)-5,5,9-trimethyl-3,15-dioxo-11-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
| SMILES | COC[C@H]1C(=O)[C@]23C[C@H]1C[C@H](OC(C)=O)[C@H]2[C@]1(C)[C@@H](OC(C)=O)C[C@H](O)C(C)(C)[C@H]1C(=O)[C@@H]3O |
| InChI | InChI=1S/C25H36O9/c1-11(26)33-15-7-13-9-25(21(30)14(13)10-32-6)19(15)24(5)17(34-12(2)27)8-16(28)23(3,4)20(24)18(29)22(25)31/h13-17,19-20,22,28,31H,7-10H2,1-6H3/t13-,14-,15+,16+,17+,19+,20-,22+,24+,25+/m1/s1 |
| InChIKey | OTJFFMFHSOWOQW-KVLNNNEYSA-N |
| XLogP | 1.06 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |