About N-[4-(4-chlorophenyl)-3-cyano-4H-pyrano[3,2-h]quinolin-2-yl]-N'-methylmethanimidamide
N-[4-(4-chlorophenyl)-3-cyano-4H-pyrano[3,2-h]quinolin-2-yl]-N'-methylmethanimidamide (PubChem CID 71577674) has the molecular formula C21H15ClN4O
and a molecular weight of 374.83 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-3-cyano-4H-pyrano[3,2-h]quinolin-2-yl]-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-[4-(4-chlorophenyl)-3-cyano-4H-pyrano[3,2-h]quinolin-2-yl]-N'-methylmethanimidamide |
| PubChem CID | 71577674 |
| Molecular Formula | C21H15ClN4O |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N-[4-(4-chlorophenyl)-3-cyano-4H-pyrano[3,2-h]quinolin-2-yl]-N'-methylmethanimidamide |
| SMILES | C/N=C/NC1=C(C#N)C(c2ccc(Cl)cc2)c2ccc3cccnc3c2O1 |
| InChI | InChI=1S/C21H15ClN4O/c1-24-12-26-21-17(11-23)18(13-4-7-15(22)8-5-13)16-9-6-14-3-2-10-25-19(14)20(16)27-21/h2-10,12,18H,1H3,(H,24,26) |
| InChIKey | DYZJDIIARKUKPK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(4-chlorophenyl)-3-cyano-4H-pyrano[3,2-h]quinolin-2-yl]-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4-chlorophenyl)-3-cyano-4H-pyrano[3,2-h]quinolin-2-yl]-N'-methylmethanimidamide?
The IUPAC name of N-[4-(4-chlorophenyl)-3-cyano-4H-pyrano[3,2-h]quinolin-2-yl]-N'-methylmethanimidamide (CID 71577674) is N-[4-(4-chlorophenyl)-3-cyano-4H-pyrano[3,2-h]quinolin-2-yl]-N'-methylmethanimidamide.
What is the SMILES notation for N-[4-(4-chlorophenyl)-3-cyano-4H-pyrano[3,2-h]quinolin-2-yl]-N'-methylmethanimidamide?
The canonical SMILES for N-[4-(4-chlorophenyl)-3-cyano-4H-pyrano[3,2-h]quinolin-2-yl]-N'-methylmethanimidamide is C/N=C/NC1=C(C#N)C(c2ccc(Cl)cc2)c2ccc3cccnc3c2O1.
What is the InChIKey of N-[4-(4-chlorophenyl)-3-cyano-4H-pyrano[3,2-h]quinolin-2-yl]-N'-methylmethanimidamide?
The InChIKey is DYZJDIIARKUKPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15ClN4O/c1-24-12-26-21-17(11-23)18(13-4-7-15(22)8-5-13)16-9-6-14-3-2-10-25-19(14)20(16)27-21/h2-10,12,18H,1H3,(H,24,26).
What are the key properties of N-[4-(4-chlorophenyl)-3-cyano-4H-pyrano[3,2-h]quinolin-2-yl]-N'-methylmethanimidamide?
N-[4-(4-chlorophenyl)-3-cyano-4H-pyrano[3,2-h]quinolin-2-yl]-N'-methylmethanimidamide has a molecular weight of 374.83 g/mol, XLogP of 4.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4-chlorophenyl)-3-cyano-4H-pyrano[3,2-h]quinolin-2-yl]-N'-methylmethanimidamide is sourced from PubChem (CID 71577674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).