About N-[(1,3-diphenylpyrazol-4-yl)-(2-hydroxynaphthalen-1-yl)methyl]acetamide
N-[(1,3-diphenylpyrazol-4-yl)-(2-hydroxynaphthalen-1-yl)methyl]acetamide (PubChem CID 71577834) has the molecular formula C28H23N3O2
and a molecular weight of 433.51 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)-(2-hydroxynaphthalen-1-yl)methyl]acetamide.
Molecular Properties
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)-(2-hydroxynaphthalen-1-yl)methyl]acetamide |
| PubChem CID | 71577834 |
| Molecular Formula | C28H23N3O2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)-(2-hydroxynaphthalen-1-yl)methyl]acetamide |
| SMILES | CC(=O)NC(c1cn(-c2ccccc2)nc1-c1ccccc1)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C28H23N3O2/c1-19(32)29-28(26-23-15-9-8-10-20(23)16-17-25(26)33)24-18-31(22-13-6-3-7-14-22)30-27(24)21-11-4-2-5-12-21/h2-18,28,33H,1H3,(H,29,32) |
| InChIKey | BDVFQYICLUROIP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze N-[(1,3-diphenylpyrazol-4-yl)-(2-hydroxynaphthalen-1-yl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,3-diphenylpyrazol-4-yl)-(2-hydroxynaphthalen-1-yl)methyl]acetamide?
The IUPAC name of N-[(1,3-diphenylpyrazol-4-yl)-(2-hydroxynaphthalen-1-yl)methyl]acetamide (CID 71577834) is N-[(1,3-diphenylpyrazol-4-yl)-(2-hydroxynaphthalen-1-yl)methyl]acetamide.
What is the SMILES notation for N-[(1,3-diphenylpyrazol-4-yl)-(2-hydroxynaphthalen-1-yl)methyl]acetamide?
The canonical SMILES for N-[(1,3-diphenylpyrazol-4-yl)-(2-hydroxynaphthalen-1-yl)methyl]acetamide is CC(=O)NC(c1cn(-c2ccccc2)nc1-c1ccccc1)c1c(O)ccc2ccccc12.
What is the InChIKey of N-[(1,3-diphenylpyrazol-4-yl)-(2-hydroxynaphthalen-1-yl)methyl]acetamide?
The InChIKey is BDVFQYICLUROIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H23N3O2/c1-19(32)29-28(26-23-15-9-8-10-20(23)16-17-25(26)33)24-18-31(22-13-6-3-7-14-22)30-27(24)21-11-4-2-5-12-21/h2-18,28,33H,1H3,(H,29,32).
What are the key properties of N-[(1,3-diphenylpyrazol-4-yl)-(2-hydroxynaphthalen-1-yl)methyl]acetamide?
N-[(1,3-diphenylpyrazol-4-yl)-(2-hydroxynaphthalen-1-yl)methyl]acetamide has a molecular weight of 433.51 g/mol, XLogP of 5.62, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,3-diphenylpyrazol-4-yl)-(2-hydroxynaphthalen-1-yl)methyl]acetamide is sourced from PubChem (CID 71577834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).