C10H8O6 — CID 71578700
(2S,6S,8R)-8-methyl-3,7,11-trioxatricyclo[7.3.0.02,6]dodec-1(9)-ene-4,10,12-trione (PubChem CID 71578700) has the molecular formula C10H8O6 and a molecular weight of 224.17 g/mol. Its IUPAC name is (2S,6S,8R)-8-methyl-3,7,11-trioxatricyclo[7.3.0.02,6]dodec-1(9)-ene-4,10,12-trione.
| Compound Name | (2S,6S,8R)-8-methyl-3,7,11-trioxatricyclo[7.3.0.02,6]dodec-1(9)-ene-4,10,12-trione |
|---|---|
| PubChem CID | 71578700 |
| Molecular Formula | C10H8O6 |
| Molecular Weight | 224.17 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | (2S,6S,8R)-8-methyl-3,7,11-trioxatricyclo[7.3.0.02,6]dodec-1(9)-ene-4,10,12-trione |
| SMILES | C[C@H]1O[C@H]2CC(=O)O[C@H]2C2=C1C(=O)OC2=O |
| InChI | InChI=1S/C10H8O6/c1-3-6-7(10(13)16-9(6)12)8-4(14-3)2-5(11)15-8/h3-4,8H,2H2,1H3/t3-,4+,8-/m1/s1 |
| InChIKey | LQQMQQDPPUOFTL-PDJPSNROSA-N |
| XLogP | -0.53 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.17 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|