C10H10O5 — CID 71578702
(2S,6S,8R)-8-methyl-3,7,11-trioxatricyclo[7.3.0.02,6]dodec-1(9)-ene-4,12-dione (PubChem CID 71578702) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is (2S,6S,8R)-8-methyl-3,7,11-trioxatricyclo[7.3.0.02,6]dodec-1(9)-ene-4,12-dione.
| Compound Name | (2S,6S,8R)-8-methyl-3,7,11-trioxatricyclo[7.3.0.02,6]dodec-1(9)-ene-4,12-dione |
|---|---|
| PubChem CID | 71578702 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | (2S,6S,8R)-8-methyl-3,7,11-trioxatricyclo[7.3.0.02,6]dodec-1(9)-ene-4,12-dione |
| SMILES | C[C@H]1O[C@H]2CC(=O)O[C@H]2C2=C1COC2=O |
| InChI | InChI=1S/C10H10O5/c1-4-5-3-13-10(12)8(5)9-6(14-4)2-7(11)15-9/h4,6,9H,2-3H2,1H3/t4-,6+,9-/m1/s1 |
| InChIKey | ZZHFHBFJQXGLSP-MFCLVGODSA-N |
| XLogP | -0.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |