C15H20O3 — CID 71578716
(2Z,4Z,7Z)-5-(2-hydroxypropan-2-yl)-2,8-dimethylcyclodeca-2,4,7-triene-1,6-dione (PubChem CID 71578716) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (2Z,4Z,7Z)-5-(2-hydroxypropan-2-yl)-2,8-dimethylcyclodeca-2,4,7-triene-1,6-dione.
| Compound Name | (2Z,4Z,7Z)-5-(2-hydroxypropan-2-yl)-2,8-dimethylcyclodeca-2,4,7-triene-1,6-dione |
|---|---|
| PubChem CID | 71578716 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (2Z,4Z,7Z)-5-(2-hydroxypropan-2-yl)-2,8-dimethylcyclodeca-2,4,7-triene-1,6-dione |
| SMILES | C/C1=C/C(=O)/C(C(C)(C)O)=C\C=C(\C)C(=O)CC1 |
| InChI | InChI=1S/C15H20O3/c1-10-5-8-13(16)11(2)6-7-12(14(17)9-10)15(3,4)18/h6-7,9,18H,5,8H2,1-4H3/b10-9-,11-6-,12-7+ |
| InChIKey | GWPVAGOEFQQHES-YVWWBNQGSA-N |
| XLogP | 2.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |