C24H28NO4+ — CID 7157882
ethyl 9-cyclohexyl-4-methyl-3,11-dioxa-9-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene-5-carboxylate (PubChem CID 7157882) has the molecular formula C24H28NO4+ and a molecular weight of 394.49 g/mol. Its IUPAC name is ethyl 9-cyclohexyl-4-methyl-3,11-dioxa-9-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene-5-carboxylate.
| Compound Name | ethyl 9-cyclohexyl-4-methyl-3,11-dioxa-9-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 7157882 |
| Molecular Formula | C24H28NO4+ |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | ethyl 9-cyclohexyl-4-methyl-3,11-dioxa-9-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2c1c1c(c3ccccc32)OC[NH+](C2CCCCC2)C1 |
| InChI | InChI=1S/C24H27NO4/c1-3-27-24(26)20-15(2)29-23-18-12-8-7-11-17(18)22-19(21(20)23)13-25(14-28-22)16-9-5-4-6-10-16/h7-8,11-12,16H,3-6,9-10,13-14H2,1-2H3/p+1 |
| InChIKey | IYFUUISGSWLVLV-UHFFFAOYSA-O |
| XLogP | 4.14 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |