C24H35NO4 — CID 71579035
tert-butyl 2-[(2R,4R,6R)-6-[2-[bis(prop-2-enyl)amino]ethyl]-2-phenyl-1,3-dioxan-4-yl]acetate (PubChem CID 71579035) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is tert-butyl 2-[(2R,4R,6R)-6-[2-[bis(prop-2-enyl)amino]ethyl]-2-phenyl-1,3-dioxan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(2R,4R,6R)-6-[2-[bis(prop-2-enyl)amino]ethyl]-2-phenyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 71579035 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | tert-butyl 2-[(2R,4R,6R)-6-[2-[bis(prop-2-enyl)amino]ethyl]-2-phenyl-1,3-dioxan-4-yl]acetate |
| SMILES | C=CCN(CC=C)CC[C@@H]1C[C@H](CC(=O)OC(C)(C)C)O[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C24H35NO4/c1-6-14-25(15-7-2)16-13-20-17-21(18-22(26)29-24(3,4)5)28-23(27-20)19-11-9-8-10-12-19/h6-12,20-21,23H,1-2,13-18H2,3-5H3/t20-,21-,23-/m1/s1 |
| InChIKey | MMFBDXLBQYNMBV-MQSCRBSSSA-N |
| XLogP | 4.66 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|