C20H32O4 — CID 71579048
(2S,4bS,8R,8aR,10R)-2,10-dihydroxy-8-(hydroxymethyl)-4b,8-dimethyl-2-propan-2-yl-1,3,5,6,7,8a,9,10-octahydrophenanthren-4-one (PubChem CID 71579048) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (2S,4bS,8R,8aR,10R)-2,10-dihydroxy-8-(hydroxymethyl)-4b,8-dimethyl-2-propan-2-yl-1,3,5,6,7,8a,9,10-octahydrophenanthren-4-one.
| Compound Name | (2S,4bS,8R,8aR,10R)-2,10-dihydroxy-8-(hydroxymethyl)-4b,8-dimethyl-2-propan-2-yl-1,3,5,6,7,8a,9,10-octahydrophenanthren-4-one |
|---|---|
| PubChem CID | 71579048 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (2S,4bS,8R,8aR,10R)-2,10-dihydroxy-8-(hydroxymethyl)-4b,8-dimethyl-2-propan-2-yl-1,3,5,6,7,8a,9,10-octahydrophenanthren-4-one |
| SMILES | CC(C)[C@@]1(O)CC(=O)C2=C(C1)[C@H](O)C[C@H]1[C@](C)(CO)CCC[C@]21C |
| InChI | InChI=1S/C20H32O4/c1-12(2)20(24)9-13-14(22)8-16-18(3,11-21)6-5-7-19(16,4)17(13)15(23)10-20/h12,14,16,21-22,24H,5-11H2,1-4H3/t14-,16+,18+,19+,20+/m1/s1 |
| InChIKey | QJBRRHRRFOMXBL-KXAOQFNBSA-N |
| XLogP | 2.60 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |