C26H28N4O3 — CID 71579114
(1'R,4'S)-2',2'-dimethyl-3-[3-(3-nitrophenyl)-2-phenyl-3,4-dihydropyrazol-5-yl]spiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane] (PubChem CID 71579114) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is (1'R,4'S)-2',2'-dimethyl-3-[3-(3-nitrophenyl)-2-phenyl-3,4-dihydropyrazol-5-yl]spiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane].
| Compound Name | (1'R,4'S)-2',2'-dimethyl-3-[3-(3-nitrophenyl)-2-phenyl-3,4-dihydropyrazol-5-yl]spiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane] |
|---|---|
| PubChem CID | 71579114 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | (1'R,4'S)-2',2'-dimethyl-3-[3-(3-nitrophenyl)-2-phenyl-3,4-dihydropyrazol-5-yl]spiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane] |
| SMILES | CC1(C)[C@@H]2CC[C@@H](C2)C12CC(C1=NN(c3ccccc3)C(c3cccc([N+](=O)[O-])c3)C1)=NO2 |
| InChI | InChI=1S/C26H28N4O3/c1-25(2)18-11-12-19(14-18)26(25)16-23(28-33-26)22-15-24(17-7-6-10-21(13-17)30(31)32)29(27-22)20-8-4-3-5-9-20/h3-10,13,18-19,24H,11-12,14-16H2,1-2H3/t18-,19+,24?,26?/m1/s1 |
| InChIKey | PAWNEBVURNLZDD-ZSHFYGRISA-N |
| XLogP | 5.87 |
| TPSA | 80.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|