C27H31N3O — CID 71579115
(1'R,4'S)-2',2'-dimethyl-3-[3-(4-methylphenyl)-2-phenyl-3,4-dihydropyrazol-5-yl]spiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane] (PubChem CID 71579115) has the molecular formula C27H31N3O and a molecular weight of 413.57 g/mol. Its IUPAC name is (1'R,4'S)-2',2'-dimethyl-3-[3-(4-methylphenyl)-2-phenyl-3,4-dihydropyrazol-5-yl]spiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane].
| Compound Name | (1'R,4'S)-2',2'-dimethyl-3-[3-(4-methylphenyl)-2-phenyl-3,4-dihydropyrazol-5-yl]spiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane] |
|---|---|
| PubChem CID | 71579115 |
| Molecular Formula | C27H31N3O |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | (1'R,4'S)-2',2'-dimethyl-3-[3-(4-methylphenyl)-2-phenyl-3,4-dihydropyrazol-5-yl]spiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane] |
| SMILES | Cc1ccc(C2CC(C3=NOC4(C3)[C@H]3CC[C@H](C3)C4(C)C)=NN2c2ccccc2)cc1 |
| InChI | InChI=1S/C27H31N3O/c1-18-9-11-19(12-10-18)25-16-23(28-30(25)22-7-5-4-6-8-22)24-17-27(31-29-24)21-14-13-20(15-21)26(27,2)3/h4-12,20-21,25H,13-17H2,1-3H3/t20-,21+,25?,27?/m1/s1 |
| InChIKey | CEHRSNJCZREYSH-ZNNWATIJSA-N |
| XLogP | 6.27 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |